C22H28O4S — CID 54110756
2-[1-hydroxy-2-(3-methylphenyl)cyclohexyl]ethyl 4-methylbenzenesulfonate (PubChem CID 54110756) has the molecular formula C22H28O4S and a molecular weight of 388.53 g/mol. Its IUPAC name is 2-[1-hydroxy-2-(3-methylphenyl)cyclohexyl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[1-hydroxy-2-(3-methylphenyl)cyclohexyl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54110756 |
| Molecular Formula | C22H28O4S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-[1-hydroxy-2-(3-methylphenyl)cyclohexyl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC2(O)CCCCC2c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C22H28O4S/c1-17-9-11-20(12-10-17)27(24,25)26-15-14-22(23)13-4-3-8-21(22)19-7-5-6-18(2)16-19/h5-7,9-12,16,21,23H,3-4,8,13-15H2,1-2H3 |
| InChIKey | NGXUHWFUDFXQLG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|