C29H38O4 — CID 11867995
[(3R,5R,8R,9R,10S,13R,14R,17S)-3-acetyloxy-10,13-dimethyl-7-methylidene-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] benzoate (PubChem CID 11867995) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is [(3R,5R,8R,9R,10S,13R,14R,17S)-3-acetyloxy-10,13-dimethyl-7-methylidene-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] benzoate.
| Compound Name | [(3R,5R,8R,9R,10S,13R,14R,17S)-3-acetyloxy-10,13-dimethyl-7-methylidene-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] benzoate |
|---|---|
| PubChem CID | 11867995 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | [(3R,5R,8R,9R,10S,13R,14R,17S)-3-acetyloxy-10,13-dimethyl-7-methylidene-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] benzoate |
| SMILES | C=C1C[C@@H]2C[C@H](OC(C)=O)CC[C@]2(C)[C@@H]2CC[C@@]3(C)[C@@H](OC(=O)c4ccccc4)CC[C@@H]3[C@H]12 |
| InChI | InChI=1S/C29H38O4/c1-18-16-21-17-22(32-19(2)30)12-14-28(21,3)24-13-15-29(4)23(26(18)24)10-11-25(29)33-27(31)20-8-6-5-7-9-20/h5-9,21-26H,1,10-17H2,2-4H3/t21-,22-,23-,24-,25+,26+,28+,29-/m1/s1 |
| InChIKey | IQNLADADEQVSMP-GVXLPEBISA-N |
| XLogP | 6.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|