C34H40O4 — CID 11868160
[(3S,5S,8S,9S,10S,13S,14S,17S)-17-benzoyloxy-10,13-dimethyl-7-methylidene-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 11868160) has the molecular formula C34H40O4 and a molecular weight of 512.69 g/mol. Its IUPAC name is [(3S,5S,8S,9S,10S,13S,14S,17S)-17-benzoyloxy-10,13-dimethyl-7-methylidene-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(3S,5S,8S,9S,10S,13S,14S,17S)-17-benzoyloxy-10,13-dimethyl-7-methylidene-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 11868160 |
| Molecular Formula | C34H40O4 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | [(3S,5S,8S,9S,10S,13S,14S,17S)-17-benzoyloxy-10,13-dimethyl-7-methylidene-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | C=C1C[C@H]2C[C@@H](OC(=O)c3ccccc3)CC[C@]2(C)[C@H]2CC[C@]3(C)[C@@H](OC(=O)c4ccccc4)CC[C@H]3[C@@H]12 |
| InChI | InChI=1S/C34H40O4/c1-22-20-25-21-26(37-31(35)23-10-6-4-7-11-23)16-18-33(25,2)28-17-19-34(3)27(30(22)28)14-15-29(34)38-32(36)24-12-8-5-9-13-24/h4-13,25-30H,1,14-21H2,2-3H3/t25-,26-,27-,28-,29-,30+,33-,34-/m0/s1 |
| InChIKey | JHCBWMWBLGNBKR-IVOZQMMGSA-N |
| XLogP | 7.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|