C34H53F — CID 144586873
12a-(2-fluoroethyl)-3,3,7,10a-tetramethyl-8-(2-methylbut-3-en-2-yl)-5-methylidene-7-(2-methylprop-1-enyl)-2,4,4a,4b,8,9,10,10b,11,12-decahydro-1H-chrysene (PubChem CID 144586873) has the molecular formula C34H53F and a molecular weight of 480.80 g/mol. Its IUPAC name is 12a-(2-fluoroethyl)-3,3,7,10a-tetramethyl-8-(2-methylbut-3-en-2-yl)-5-methylidene-7-(2-methylprop-1-enyl)-2,4,4a,4b,8,9,10,10b,11,12-decahydro-1H-chrysene.
| Compound Name | 12a-(2-fluoroethyl)-3,3,7,10a-tetramethyl-8-(2-methylbut-3-en-2-yl)-5-methylidene-7-(2-methylprop-1-enyl)-2,4,4a,4b,8,9,10,10b,11,12-decahydro-1H-chrysene |
|---|---|
| PubChem CID | 144586873 |
| Molecular Formula | C34H53F |
| Molecular Weight | 480.80 g/mol |
| Exact Mass | 480.41 |
| IUPAC Name | 12a-(2-fluoroethyl)-3,3,7,10a-tetramethyl-8-(2-methylbut-3-en-2-yl)-5-methylidene-7-(2-methylprop-1-enyl)-2,4,4a,4b,8,9,10,10b,11,12-decahydro-1H-chrysene |
| SMILES | C=CC(C)(C)C1CCC2(C)C(=CC(=C)C3C4CC(C)(C)CCC4(CCF)CCC32)C1(C)C=C(C)C |
| InChI | InChI=1S/C34H53F/c1-11-31(7,8)27-13-14-32(9)25-12-15-34(18-19-35)17-16-30(5,6)22-26(34)29(25)24(4)20-28(32)33(27,10)21-23(2)3/h11,20-21,25-27,29H,1,4,12-19,22H2,2-3,5-10H3 |
| InChIKey | QDDGQVWYGKVFII-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.80 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|