C32H56 — CID 143136521
(7S,10aR,12aS)-8-tert-butyl-3,3,7,10a,12a-pentamethyl-7-propyl-1,2,4,4a,6,6a,8,9,10,10b,11,12-dodecahydrochrysene;ethene (PubChem CID 143136521) has the molecular formula C32H56 and a molecular weight of 440.80 g/mol. Its IUPAC name is (7S,10aR,12aS)-8-tert-butyl-3,3,7,10a,12a-pentamethyl-7-propyl-1,2,4,4a,6,6a,8,9,10,10b,11,12-dodecahydrochrysene;ethene.
| Compound Name | (7S,10aR,12aS)-8-tert-butyl-3,3,7,10a,12a-pentamethyl-7-propyl-1,2,4,4a,6,6a,8,9,10,10b,11,12-dodecahydrochrysene;ethene |
|---|---|
| PubChem CID | 143136521 |
| Molecular Formula | C32H56 |
| Molecular Weight | 440.80 g/mol |
| Exact Mass | 440.44 |
| IUPAC Name | (7S,10aR,12aS)-8-tert-butyl-3,3,7,10a,12a-pentamethyl-7-propyl-1,2,4,4a,6,6a,8,9,10,10b,11,12-dodecahydrochrysene;ethene |
| SMILES | C=C.CCC[C@@]1(C)C(C(C)(C)C)CC[C@@]2(C)C3CC[C@@]4(C)CCC(C)(C)CC4C3=CCC21 |
| InChI | InChI=1S/C30H52.C2H4/c1-10-15-30(9)24(26(2,3)4)14-17-29(8)22-13-16-28(7)19-18-27(5,6)20-23(28)21(22)11-12-25(29)30;1-2/h11,22-25H,10,12-20H2,1-9H3;1-2H2/t22?,23?,24?,25?,28-,29-,30-;/m0./s1 |
| InChIKey | DMCTXBOSKTXYBQ-CZUWDGKZSA-N |
| XLogP | 10.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.80 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|