C29H46 — CID 15427754
(4aS,6aR,6bS,8aR,12aR,14aR,14bS)-4,6a,6b,8a,11,11,14b-heptamethyl-2,4a,5,6,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picene (PubChem CID 15427754) has the molecular formula C29H46 and a molecular weight of 394.69 g/mol. Its IUPAC name is (4aS,6aR,6bS,8aR,12aR,14aR,14bS)-4,6a,6b,8a,11,11,14b-heptamethyl-2,4a,5,6,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picene.
| Compound Name | (4aS,6aR,6bS,8aR,12aR,14aR,14bS)-4,6a,6b,8a,11,11,14b-heptamethyl-2,4a,5,6,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picene |
|---|---|
| PubChem CID | 15427754 |
| Molecular Formula | C29H46 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.36 |
| IUPAC Name | (4aS,6aR,6bS,8aR,12aR,14aR,14bS)-4,6a,6b,8a,11,11,14b-heptamethyl-2,4a,5,6,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picene |
| SMILES | CC1=CCC[C@]2(C)[C@H]3CC=C4[C@@H]5CC(C)(C)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C29H46/c1-20-9-8-13-27(5)21(20)12-14-29(7)24(27)11-10-22-23-19-25(2,3)15-16-26(23,4)17-18-28(22,29)6/h9-10,21,23-24H,8,11-19H2,1-7H3/t21-,23-,24+,26+,27-,28+,29+/m0/s1 |
| InChIKey | BUSIZDBOZRBEOT-PZUQKJEFSA-N |
| XLogP | 8.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|