C24H38 — CID 23256690
(4aR,6aR,10aR,10bS,12aR)-3,3,7,10a,10b,12a-hexamethyl-1,2,4,4a,6,6a,9,10,11,12-decahydrochrysene (PubChem CID 23256690) has the molecular formula C24H38 and a molecular weight of 326.57 g/mol. Its IUPAC name is (4aR,6aR,10aR,10bS,12aR)-3,3,7,10a,10b,12a-hexamethyl-1,2,4,4a,6,6a,9,10,11,12-decahydrochrysene.
| Compound Name | (4aR,6aR,10aR,10bS,12aR)-3,3,7,10a,10b,12a-hexamethyl-1,2,4,4a,6,6a,9,10,11,12-decahydrochrysene |
|---|---|
| PubChem CID | 23256690 |
| Molecular Formula | C24H38 |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.30 |
| IUPAC Name | (4aR,6aR,10aR,10bS,12aR)-3,3,7,10a,10b,12a-hexamethyl-1,2,4,4a,6,6a,9,10,11,12-decahydrochrysene |
| SMILES | CC1=CCC[C@]2(C)[C@@H]1CC=C1[C@@H]3CC(C)(C)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C24H38/c1-17-8-7-11-23(5)18(17)9-10-19-20-16-21(2,3)12-13-22(20,4)14-15-24(19,23)6/h8,10,18,20H,7,9,11-16H2,1-6H3/t18-,20+,22-,23-,24-/m1/s1 |
| InChIKey | GQFGWUOYUZBTDM-ROKMFXFQSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|