C30H48 — CID 101281086
(5aR,5bS,7aR,11aR,13aR,13bR)-5a,5b,7a,10,10,13b-hexamethyl-3-propan-2-yl-1,2,4,5,6,7,8,9,11,11a,13,13a-dodecahydrocyclopenta[a]chrysene (PubChem CID 101281086) has the molecular formula C30H48 and a molecular weight of 408.71 g/mol. Its IUPAC name is (5aR,5bS,7aR,11aR,13aR,13bR)-5a,5b,7a,10,10,13b-hexamethyl-3-propan-2-yl-1,2,4,5,6,7,8,9,11,11a,13,13a-dodecahydrocyclopenta[a]chrysene.
| Compound Name | (5aR,5bS,7aR,11aR,13aR,13bR)-5a,5b,7a,10,10,13b-hexamethyl-3-propan-2-yl-1,2,4,5,6,7,8,9,11,11a,13,13a-dodecahydrocyclopenta[a]chrysene |
|---|---|
| PubChem CID | 101281086 |
| Molecular Formula | C30H48 |
| Molecular Weight | 408.71 g/mol |
| Exact Mass | 408.38 |
| IUPAC Name | (5aR,5bS,7aR,11aR,13aR,13bR)-5a,5b,7a,10,10,13b-hexamethyl-3-propan-2-yl-1,2,4,5,6,7,8,9,11,11a,13,13a-dodecahydrocyclopenta[a]chrysene |
| SMILES | CC(C)C1=C2CC[C@]3(C)[C@H](CC=C4[C@@H]5CC(C)(C)CC[C@]5(C)CC[C@]43C)[C@@]2(C)CC1 |
| InChI | InChI=1S/C30H48/c1-20(2)21-11-13-28(6)22(21)12-14-30(8)25(28)10-9-23-24-19-26(3,4)15-16-27(24,5)17-18-29(23,30)7/h9,20,24-25H,10-19H2,1-8H3/t24-,25+,27+,28-,29+,30+/m0/s1 |
| InChIKey | FPECACSKOMQISP-XXAVWSCOSA-N |
| XLogP | 9.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.71 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|