C28H43NO2 — CID 134437945
(9S)-N-hydroxy-2,2,6b,9,12a-pentamethyl-1,3,4,5,6,6a,6a,7,8,8a,9,12,13,14b-tetradecahydropicene-4a-carboxamide (PubChem CID 134437945) has the molecular formula C28H43NO2 and a molecular weight of 425.66 g/mol. Its IUPAC name is (9S)-N-hydroxy-2,2,6b,9,12a-pentamethyl-1,3,4,5,6,6a,6a,7,8,8a,9,12,13,14b-tetradecahydropicene-4a-carboxamide.
| Compound Name | (9S)-N-hydroxy-2,2,6b,9,12a-pentamethyl-1,3,4,5,6,6a,6a,7,8,8a,9,12,13,14b-tetradecahydropicene-4a-carboxamide |
|---|---|
| PubChem CID | 134437945 |
| Molecular Formula | C28H43NO2 |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 425.33 |
| IUPAC Name | (9S)-N-hydroxy-2,2,6b,9,12a-pentamethyl-1,3,4,5,6,6a,6a,7,8,8a,9,12,13,14b-tetradecahydropicene-4a-carboxamide |
| SMILES | C[C@H]1C=CCC2(C)C1CCC1(C)C3CCC4(C(=O)NO)CCC(C)(C)CC4C3=CCC12 |
| InChI | InChI=1S/C28H43NO2/c1-18-7-6-12-26(4)20(18)10-13-27(5)21-11-14-28(24(30)29-31)16-15-25(2,3)17-22(28)19(21)8-9-23(26)27/h6-8,18,20-23,31H,9-17H2,1-5H3,(H,29,30)/t18-,20?,21?,22?,23?,26?,27?,28?/m0/s1 |
| InChIKey | YXMQCTAMXRDJLS-JINGHNMNSA-N |
| XLogP | 6.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|