C28H44O3 — CID 142492675
(10S)-10-hydroxy-1,6b,9,9,12a-pentamethyl-1,2,3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-hexadecahydropicene-4a-carboxylic acid (PubChem CID 142492675) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is (10S)-10-hydroxy-1,6b,9,9,12a-pentamethyl-1,2,3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-hexadecahydropicene-4a-carboxylic acid.
| Compound Name | (10S)-10-hydroxy-1,6b,9,9,12a-pentamethyl-1,2,3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-hexadecahydropicene-4a-carboxylic acid |
|---|---|
| PubChem CID | 142492675 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | (10S)-10-hydroxy-1,6b,9,9,12a-pentamethyl-1,2,3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-hexadecahydropicene-4a-carboxylic acid |
| SMILES | CC1CCCC2(C(=O)O)CCC3C(=CCC4C3(C)CCC3C4(C)CC[C@H](O)C3(C)C)C12 |
| InChI | InChI=1S/C28H44O3/c1-17-7-6-13-28(24(30)31)16-10-19-18(23(17)28)8-9-21-26(19,4)14-11-20-25(2,3)22(29)12-15-27(20,21)5/h8,17,19-23,29H,6-7,9-16H2,1-5H3,(H,30,31)/t17?,19?,20?,21?,22-,23?,26?,27?,28?/m0/s1 |
| InChIKey | QRXSNEYSIFCZSD-KTCJVEAHSA-N |
| XLogP | 6.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|