C29H46O3 — CID 123887380
methyl 10-hydroxy-2,6b,9,9,12a-pentamethyl-1,2,3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-hexadecahydropicene-4a-carboxylate (PubChem CID 123887380) has the molecular formula C29H46O3 and a molecular weight of 442.68 g/mol. Its IUPAC name is methyl 10-hydroxy-2,6b,9,9,12a-pentamethyl-1,2,3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-hexadecahydropicene-4a-carboxylate.
| Compound Name | methyl 10-hydroxy-2,6b,9,9,12a-pentamethyl-1,2,3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-hexadecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 123887380 |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | methyl 10-hydroxy-2,6b,9,9,12a-pentamethyl-1,2,3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-hexadecahydropicene-4a-carboxylate |
| SMILES | COC(=O)C12CCC(C)CC1C1=CCC3C(C)(CCC4C(C)(C)C(O)CCC43C)C1CC2 |
| InChI | InChI=1S/C29H46O3/c1-18-9-15-29(25(31)32-6)16-10-20-19(21(29)17-18)7-8-23-27(20,4)13-11-22-26(2,3)24(30)12-14-28(22,23)5/h7,18,20-24,30H,8-17H2,1-6H3 |
| InChIKey | LEKFCOJQWFELAI-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|