C29H44O6 — CID 163067191
3,12-dihydroxy-4,6a,11,12,14b-pentamethyl-2,3,4a,5,6,6b,7,8,9,10,11,12a,14,14a-tetradecahydro-1H-picene-4,8a-dicarboxylic acid (PubChem CID 163067191) has the molecular formula C29H44O6 and a molecular weight of 488.67 g/mol. Its IUPAC name is 3,12-dihydroxy-4,6a,11,12,14b-pentamethyl-2,3,4a,5,6,6b,7,8,9,10,11,12a,14,14a-tetradecahydro-1H-picene-4,8a-dicarboxylic acid.
| Compound Name | 3,12-dihydroxy-4,6a,11,12,14b-pentamethyl-2,3,4a,5,6,6b,7,8,9,10,11,12a,14,14a-tetradecahydro-1H-picene-4,8a-dicarboxylic acid |
|---|---|
| PubChem CID | 163067191 |
| Molecular Formula | C29H44O6 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | 3,12-dihydroxy-4,6a,11,12,14b-pentamethyl-2,3,4a,5,6,6b,7,8,9,10,11,12a,14,14a-tetradecahydro-1H-picene-4,8a-dicarboxylic acid |
| SMILES | CC1CCC2(C(=O)O)CCC3C(=CCC4C3(C)CCC3C4(C)CCC(O)C3(C)C(=O)O)C2C1(C)O |
| InChI | InChI=1S/C29H44O6/c1-16-8-14-29(24(33)34)15-9-18-17(22(29)28(16,5)35)6-7-19-25(18,2)12-10-20-26(19,3)13-11-21(30)27(20,4)23(31)32/h6,16,18-22,30,35H,7-15H2,1-5H3,(H,31,32)(H,33,34) |
| InChIKey | BQILHYQVNXEPJB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|