C31H46O3 — CID 144908720
prop-2-ynyl 10-hydroxy-2,6b,9,9,12a-pentamethyl-1,2,3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-hexadecahydropicene-4a-carboxylate (PubChem CID 144908720) has the molecular formula C31H46O3 and a molecular weight of 466.71 g/mol. Its IUPAC name is prop-2-ynyl 10-hydroxy-2,6b,9,9,12a-pentamethyl-1,2,3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-hexadecahydropicene-4a-carboxylate.
| Compound Name | prop-2-ynyl 10-hydroxy-2,6b,9,9,12a-pentamethyl-1,2,3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-hexadecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 144908720 |
| Molecular Formula | C31H46O3 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | prop-2-ynyl 10-hydroxy-2,6b,9,9,12a-pentamethyl-1,2,3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-hexadecahydropicene-4a-carboxylate |
| SMILES | C#CCOC(=O)C12CCC(C)CC1C1=CCC3C(C)(CCC4C(C)(C)C(O)CCC43C)C1CC2 |
| InChI | InChI=1S/C31H46O3/c1-7-18-34-27(33)31-16-10-20(2)19-23(31)21-8-9-25-29(5,22(21)11-17-31)14-12-24-28(3,4)26(32)13-15-30(24,25)6/h1,8,20,22-26,32H,9-19H2,2-6H3 |
| InChIKey | AMAKDSJDAPCAAJ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|