C37H58O4 — CID 144908716
(4,4,6a,11,14b-pentamethyl-8a-prop-2-enyl-1,2,3,4a,5,6,6b,7,8,9,10,11,12,12a,14,14a-hexadecahydropicen-3-yl) pent-4-ynoate;formic acid;methane (PubChem CID 144908716) has the molecular formula C37H58O4 and a molecular weight of 566.87 g/mol. Its IUPAC name is (4,4,6a,11,14b-pentamethyl-8a-prop-2-enyl-1,2,3,4a,5,6,6b,7,8,9,10,11,12,12a,14,14a-hexadecahydropicen-3-yl) pent-4-ynoate;formic acid;methane.
| Compound Name | (4,4,6a,11,14b-pentamethyl-8a-prop-2-enyl-1,2,3,4a,5,6,6b,7,8,9,10,11,12,12a,14,14a-hexadecahydropicen-3-yl) pent-4-ynoate;formic acid;methane |
|---|---|
| PubChem CID | 144908716 |
| Molecular Formula | C37H58O4 |
| Molecular Weight | 566.87 g/mol |
| Exact Mass | 566.43 |
| IUPAC Name | (4,4,6a,11,14b-pentamethyl-8a-prop-2-enyl-1,2,3,4a,5,6,6b,7,8,9,10,11,12,12a,14,14a-hexadecahydropicen-3-yl) pent-4-ynoate;formic acid;methane |
| SMILES | C.C#CCCC(=O)OC1CCC2(C)C(CCC3(C)C4CCC5(CC=C)CCC(C)CC5C4=CCC32)C1(C)C.O=CO |
| InChI | InChI=1S/C35H52O2.CH2O2.CH4/c1-8-10-11-31(36)37-30-17-20-34(7)28(32(30,4)5)16-19-33(6)26-15-22-35(18-9-2)21-14-24(3)23-27(35)25(26)12-13-29(33)34;2-1-3;/h1,9,12,24,26-30H,2,10-11,13-23H2,3-7H3;1H,(H,2,3);1H4 |
| InChIKey | IVZCPPARKHIJMA-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.87 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|