C34H54O6 — CID 155378531
10-(3,5-dihydroxyoxan-2-yl)oxy-2,2,6b,9,9,12a-hexamethyl-3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid (PubChem CID 155378531) has the molecular formula C34H54O6 and a molecular weight of 558.80 g/mol. Its IUPAC name is 10-(3,5-dihydroxyoxan-2-yl)oxy-2,2,6b,9,9,12a-hexamethyl-3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid.
| Compound Name | 10-(3,5-dihydroxyoxan-2-yl)oxy-2,2,6b,9,9,12a-hexamethyl-3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
|---|---|
| PubChem CID | 155378531 |
| Molecular Formula | C34H54O6 |
| Molecular Weight | 558.80 g/mol |
| Exact Mass | 558.39 |
| IUPAC Name | 10-(3,5-dihydroxyoxan-2-yl)oxy-2,2,6b,9,9,12a-hexamethyl-3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
| SMILES | CC1(C)CCC2(C(=O)O)CCC3C(=CCC4C3(C)CCC3C(C)(C)C(OC5OCC(O)CC5O)CCC34C)C2C1 |
| InChI | InChI=1S/C34H54O6/c1-30(2)15-16-34(29(37)38)14-9-22-21(23(34)18-30)7-8-26-32(22,5)12-10-25-31(3,4)27(11-13-33(25,26)6)40-28-24(36)17-20(35)19-39-28/h7,20,22-28,35-36H,8-19H2,1-6H3,(H,37,38) |
| InChIKey | KIYAPZADJAPJKH-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.80 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|