C32H51NO4 — CID 167310054
(2-amino-2-oxoethyl) (1S,2R,4aS,6aS,6bR,10S,12aR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate (PubChem CID 167310054) has the molecular formula C32H51NO4 and a molecular weight of 513.76 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (1S,2R,4aS,6aS,6bR,10S,12aR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate.
| Compound Name | (2-amino-2-oxoethyl) (1S,2R,4aS,6aS,6bR,10S,12aR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 167310054 |
| Molecular Formula | C32H51NO4 |
| Molecular Weight | 513.76 g/mol |
| Exact Mass | 513.38 |
| IUPAC Name | (2-amino-2-oxoethyl) (1S,2R,4aS,6aS,6bR,10S,12aR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
| SMILES | C[C@@H]1CC[C@]2(C(=O)OCC(N)=O)CC[C@]3(C)C(=CCC4[C@@]5(C)CC[C@H](O)C(C)(C)C5CC[C@]43C)C2[C@H]1C |
| InChI | InChI=1S/C32H51NO4/c1-19-10-15-32(27(36)37-18-25(33)35)17-16-30(6)21(26(32)20(19)2)8-9-23-29(5)13-12-24(34)28(3,4)22(29)11-14-31(23,30)7/h8,19-20,22-24,26,34H,9-18H2,1-7H3,(H2,33,35)/t19-,20+,22?,23?,24+,26?,29+,30-,31-,32+/m1/s1 |
| InChIKey | OXDSWPFNOQXTHC-DIBPWRRCSA-N |
| XLogP | 6.03 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.76 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|