C36H60N2O3 — CID 71458476
2-piperazin-1-ylethyl (1S,2R,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate (PubChem CID 71458476) has the molecular formula C36H60N2O3 and a molecular weight of 568.89 g/mol. Its IUPAC name is 2-piperazin-1-ylethyl (1S,2R,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate.
| Compound Name | 2-piperazin-1-ylethyl (1S,2R,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 71458476 |
| Molecular Formula | C36H60N2O3 |
| Molecular Weight | 568.89 g/mol |
| Exact Mass | 568.46 |
| IUPAC Name | 2-piperazin-1-ylethyl (1S,2R,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
| SMILES | C[C@H]1[C@H](C)CC[C@]2(C(=O)OCCN3CCNCC3)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@H]12 |
| InChI | InChI=1S/C36H60N2O3/c1-24-10-15-36(31(40)41-23-22-38-20-18-37-19-21-38)17-16-34(6)26(30(36)25(24)2)8-9-28-33(5)13-12-29(39)32(3,4)27(33)11-14-35(28,34)7/h8,24-25,27-30,37,39H,9-23H2,1-7H3/t24-,25+,27+,28-,29+,30+,33+,34-,35-,36+/m1/s1 |
| InChIKey | KCRBTBCANCAEQU-JMBNEQOHSA-N |
| XLogP | 6.45 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.89 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|