C33H54O3 — CID 45257229
propan-2-yl (1S,2R,4aS,6aS,6bR,10S,12aR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate (PubChem CID 45257229) has the molecular formula C33H54O3 and a molecular weight of 498.79 g/mol. Its IUPAC name is propan-2-yl (1S,2R,4aS,6aS,6bR,10S,12aR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate.
| Compound Name | propan-2-yl (1S,2R,4aS,6aS,6bR,10S,12aR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 45257229 |
| Molecular Formula | C33H54O3 |
| Molecular Weight | 498.79 g/mol |
| Exact Mass | 498.41 |
| IUPAC Name | propan-2-yl (1S,2R,4aS,6aS,6bR,10S,12aR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
| SMILES | CC(C)OC(=O)[C@]12CC[C@@H](C)[C@H](C)C1C1=CCC3[C@@]4(C)CC[C@H](O)C(C)(C)C4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C33H54O3/c1-20(2)36-28(35)33-17-12-21(3)22(4)27(33)23-10-11-25-30(7)15-14-26(34)29(5,6)24(30)13-16-32(25,9)31(23,8)18-19-33/h10,20-22,24-27,34H,11-19H2,1-9H3/t21-,22+,24?,25?,26+,27?,30+,31-,32-,33+/m1/s1 |
| InChIKey | QVUVIIRQMJBPQM-AXYMLTGBSA-N |
| XLogP | 7.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.79 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|