C34H54O5 — CID 118274999
1-acetyloxyethyl (1S,2R,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate (PubChem CID 118274999) has the molecular formula C34H54O5 and a molecular weight of 542.80 g/mol. Its IUPAC name is 1-acetyloxyethyl (1S,2R,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate.
| Compound Name | 1-acetyloxyethyl (1S,2R,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 118274999 |
| Molecular Formula | C34H54O5 |
| Molecular Weight | 542.80 g/mol |
| Exact Mass | 542.40 |
| IUPAC Name | 1-acetyloxyethyl (1S,2R,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
| SMILES | CC(=O)OC(C)OC(=O)[C@]12CC[C@@H](C)[C@H](C)[C@H]1C1=CC[C@@H]3[C@@]4(C)CC[C@H](O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C34H54O5/c1-20-12-17-34(29(37)39-23(4)38-22(3)35)19-18-32(8)24(28(34)21(20)2)10-11-26-31(7)15-14-27(36)30(5,6)25(31)13-16-33(26,32)9/h10,20-21,23,25-28,36H,11-19H2,1-9H3/t20-,21+,23?,25+,26-,27+,28+,31+,32-,33-,34+/m1/s1 |
| InChIKey | UNIAGTZQQKCKMJ-XDZURVRDSA-N |
| XLogP | 7.46 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.80 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|