C30H46N4O2 — CID 163885126
(1R,2S,5S,15S,22R)-18-amino-N-hydroxy-1,2,8,8,15,22-hexamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxamide (PubChem CID 163885126) has the molecular formula C30H46N4O2 and a molecular weight of 494.72 g/mol. Its IUPAC name is (1R,2S,5S,15S,22R)-18-amino-N-hydroxy-1,2,8,8,15,22-hexamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxamide.
| Compound Name | (1R,2S,5S,15S,22R)-18-amino-N-hydroxy-1,2,8,8,15,22-hexamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxamide |
|---|---|
| PubChem CID | 163885126 |
| Molecular Formula | C30H46N4O2 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | (1R,2S,5S,15S,22R)-18-amino-N-hydroxy-1,2,8,8,15,22-hexamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxamide |
| SMILES | C[C@H]1c2[nH]nc(N)c2C[C@@]2(C)C1CC[C@]1(C)C2CC=C2C3CC(C)(C)CC[C@]3(C(=O)NO)CC[C@]21C |
| InChI | InChI=1S/C30H46N4O2/c1-17-19-9-10-29(6)22(27(19,4)15-18-23(17)32-33-24(18)31)8-7-20-21-16-26(2,3)11-13-30(21,25(35)34-36)14-12-28(20,29)5/h7,17,19,21-22,36H,8-16H2,1-6H3,(H,34,35)(H3,31,32,33)/t17-,19?,21?,22?,27+,28-,29-,30+/m1/s1 |
| InChIKey | PWROISMXOJPEJB-GTSSRPSMSA-N |
| XLogP | 6.14 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|