C33H47NO4 — CID 66547103
methyl (4aS,6aR,6aS,6bR,8aS,9S,12aS)-10-acetyloxy-11-cyano-2,2,6a,6b,9,12a-hexamethyl-3,4,5,6,6a,7,8,8a,9,12,13,14b-dodecahydro-1H-picene-4a-carboxylate (PubChem CID 66547103) has the molecular formula C33H47NO4 and a molecular weight of 521.74 g/mol. Its IUPAC name is methyl (4aS,6aR,6aS,6bR,8aS,9S,12aS)-10-acetyloxy-11-cyano-2,2,6a,6b,9,12a-hexamethyl-3,4,5,6,6a,7,8,8a,9,12,13,14b-dodecahydro-1H-picene-4a-carboxylate.
| Compound Name | methyl (4aS,6aR,6aS,6bR,8aS,9S,12aS)-10-acetyloxy-11-cyano-2,2,6a,6b,9,12a-hexamethyl-3,4,5,6,6a,7,8,8a,9,12,13,14b-dodecahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 66547103 |
| Molecular Formula | C33H47NO4 |
| Molecular Weight | 521.74 g/mol |
| Exact Mass | 521.35 |
| IUPAC Name | methyl (4aS,6aR,6aS,6bR,8aS,9S,12aS)-10-acetyloxy-11-cyano-2,2,6a,6b,9,12a-hexamethyl-3,4,5,6,6a,7,8,8a,9,12,13,14b-dodecahydro-1H-picene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)CC1C1=CC[C@@H]3[C@@]4(C)CC(C#N)=C(OC(C)=O)[C@@H](C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C33H47NO4/c1-20-23-11-12-32(7)26(30(23,5)17-22(19-34)27(20)38-21(2)35)10-9-24-25-18-29(3,4)13-15-33(25,28(36)37-8)16-14-31(24,32)6/h9,20,23,25-26H,10-18H2,1-8H3/t20-,23-,25?,26+,30-,31+,32+,33-/m0/s1 |
| InChIKey | LVJAFVIGRNSQHH-XEQKVKEVSA-N |
| XLogP | 7.52 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.74 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|