C32H51N3O2 — CID 158452031
(1R,2S,5S,15R)-18-amino-1,2,8,9,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxylic acid;methane (PubChem CID 158452031) has the molecular formula C32H51N3O2 and a molecular weight of 509.78 g/mol. Its IUPAC name is (1R,2S,5S,15R)-18-amino-1,2,8,9,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxylic acid;methane.
| Compound Name | (1R,2S,5S,15R)-18-amino-1,2,8,9,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxylic acid;methane |
|---|---|
| PubChem CID | 158452031 |
| Molecular Formula | C32H51N3O2 |
| Molecular Weight | 509.78 g/mol |
| Exact Mass | 509.40 |
| IUPAC Name | (1R,2S,5S,15R)-18-amino-1,2,8,9,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxylic acid;methane |
| SMILES | C.CC1CC[C@]2(C(=O)O)CC[C@]3(C)C(=CCC4[C@@]5(C)Cc6c(N)n[nH]c6C(C)(C)C5CC[C@]43C)C2C1C |
| InChI | InChI=1S/C31H47N3O2.CH4/c1-17-10-13-31(26(35)36)15-14-29(6)20(23(31)18(17)2)8-9-22-28(5)16-19-24(33-34-25(19)32)27(3,4)21(28)11-12-30(22,29)7;/h8,17-18,21-23H,9-16H2,1-7H3,(H,35,36)(H3,32,33,34);1H4/t17?,18?,21?,22?,23?,28-,29+,30+,31-;/m0./s1 |
| InChIKey | HECPRZYEIHJQCM-MQTPIUFHSA-N |
| XLogP | 7.38 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.78 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|