C38H57N3O2 — CID 129072373
(1R,2R,11R,14R,15S,18S,21R,22S,23S)-2,7,10,10,14,15,21,22-octamethyl-5-piperidin-1-yl-6,8-diazahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4(9),5,7,24-tetraene-18-carboxylic acid (PubChem CID 129072373) has the molecular formula C38H57N3O2 and a molecular weight of 587.89 g/mol. Its IUPAC name is (1R,2R,11R,14R,15S,18S,21R,22S,23S)-2,7,10,10,14,15,21,22-octamethyl-5-piperidin-1-yl-6,8-diazahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4(9),5,7,24-tetraene-18-carboxylic acid.
| Compound Name | (1R,2R,11R,14R,15S,18S,21R,22S,23S)-2,7,10,10,14,15,21,22-octamethyl-5-piperidin-1-yl-6,8-diazahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4(9),5,7,24-tetraene-18-carboxylic acid |
|---|---|
| PubChem CID | 129072373 |
| Molecular Formula | C38H57N3O2 |
| Molecular Weight | 587.89 g/mol |
| Exact Mass | 587.45 |
| IUPAC Name | (1R,2R,11R,14R,15S,18S,21R,22S,23S)-2,7,10,10,14,15,21,22-octamethyl-5-piperidin-1-yl-6,8-diazahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4(9),5,7,24-tetraene-18-carboxylic acid |
| SMILES | Cc1nc(N2CCCCC2)c2c(n1)C(C)(C)[C@@H]1CC[C@]3(C)[C@H](CC=C4[C@@H]5[C@@H](C)[C@H](C)CC[C@]5(C(=O)O)CC[C@]43C)[C@@]1(C)C2 |
| InChI | InChI=1S/C38H57N3O2/c1-23-14-17-38(33(42)43)19-18-36(7)27(30(38)24(23)2)12-13-29-35(6)22-26-31(34(4,5)28(35)15-16-37(29,36)8)39-25(3)40-32(26)41-20-10-9-11-21-41/h12,23-24,28-30H,9-11,13-22H2,1-8H3,(H,42,43)/t23-,24+,28+,29-,30+,35+,36-,37-,38+/m1/s1 |
| InChIKey | QGDIHYDNFPNNKM-SNJGQZPMSA-N |
| XLogP | 8.53 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.89 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|