C29H46O2 — CID 142335762
1,2,6a,6b,9,12a-hexamethyl-1,2,3,4,5,6,6a,7,8,8a,9,10,11,12,13,14b-hexadecahydropicene-4a-carboxylic acid (PubChem CID 142335762) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is 1,2,6a,6b,9,12a-hexamethyl-1,2,3,4,5,6,6a,7,8,8a,9,10,11,12,13,14b-hexadecahydropicene-4a-carboxylic acid.
| Compound Name | 1,2,6a,6b,9,12a-hexamethyl-1,2,3,4,5,6,6a,7,8,8a,9,10,11,12,13,14b-hexadecahydropicene-4a-carboxylic acid |
|---|---|
| PubChem CID | 142335762 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | 1,2,6a,6b,9,12a-hexamethyl-1,2,3,4,5,6,6a,7,8,8a,9,10,11,12,13,14b-hexadecahydropicene-4a-carboxylic acid |
| SMILES | CC1CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CCCC(C)C5CCC43C)C2C1C |
| InChI | InChI=1S/C29H46O2/c1-18-11-15-29(25(30)31)17-16-27(5)22(24(29)20(18)3)9-10-23-26(4)13-7-8-19(2)21(26)12-14-28(23,27)6/h9,18-21,23-24H,7-8,10-17H2,1-6H3,(H,30,31) |
| InChIKey | UNMRADIIDDQIPZ-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|