C29H48O4 — CID 142319365
(1S,4aS,6aS,9R,10R)-10-hydroxy-1,6a,6b,9,12a-pentamethyl-1,2,3,4,5,6,6a,7,8,8a,9,10,11,12,13,14b-hexadecahydropicene-4a-carboxylic acid;methanol (PubChem CID 142319365) has the molecular formula C29H48O4 and a molecular weight of 460.70 g/mol. Its IUPAC name is (1S,4aS,6aS,9R,10R)-10-hydroxy-1,6a,6b,9,12a-pentamethyl-1,2,3,4,5,6,6a,7,8,8a,9,10,11,12,13,14b-hexadecahydropicene-4a-carboxylic acid;methanol.
| Compound Name | (1S,4aS,6aS,9R,10R)-10-hydroxy-1,6a,6b,9,12a-pentamethyl-1,2,3,4,5,6,6a,7,8,8a,9,10,11,12,13,14b-hexadecahydropicene-4a-carboxylic acid;methanol |
|---|---|
| PubChem CID | 142319365 |
| Molecular Formula | C29H48O4 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | (1S,4aS,6aS,9R,10R)-10-hydroxy-1,6a,6b,9,12a-pentamethyl-1,2,3,4,5,6,6a,7,8,8a,9,10,11,12,13,14b-hexadecahydropicene-4a-carboxylic acid;methanol |
| SMILES | CO.C[C@@H]1C2CCC3(C)C(CC=C4C5[C@@H](C)CCC[C@]5(C(=O)O)CC[C@]43C)C2(C)CC[C@H]1O |
| InChI | InChI=1S/C28H44O3.CH4O/c1-17-7-6-12-28(24(30)31)16-15-26(4)20(23(17)28)8-9-22-25(3)13-11-21(29)18(2)19(25)10-14-27(22,26)5;1-2/h8,17-19,21-23,29H,6-7,9-16H2,1-5H3,(H,30,31);2H,1H3/t17-,18+,19?,21+,22?,23?,25?,26+,27?,28-;/m0./s1 |
| InChIKey | NECHENBEAFTLTR-GOSOFQERSA-N |
| XLogP | 6.06 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|