C30H48O2 — CID 158071137
1-[(4aS,6aS,8aS,10S)-10-hydroxy-2,2,6a,6b,9,12a-hexamethyl-3,4,5,6,6a,7,8,8a,9,10,11,12,13,14b-tetradecahydro-1H-picen-4a-yl]ethanone (PubChem CID 158071137) has the molecular formula C30H48O2 and a molecular weight of 440.71 g/mol. Its IUPAC name is 1-[(4aS,6aS,8aS,10S)-10-hydroxy-2,2,6a,6b,9,12a-hexamethyl-3,4,5,6,6a,7,8,8a,9,10,11,12,13,14b-tetradecahydro-1H-picen-4a-yl]ethanone.
| Compound Name | 1-[(4aS,6aS,8aS,10S)-10-hydroxy-2,2,6a,6b,9,12a-hexamethyl-3,4,5,6,6a,7,8,8a,9,10,11,12,13,14b-tetradecahydro-1H-picen-4a-yl]ethanone |
|---|---|
| PubChem CID | 158071137 |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | 1-[(4aS,6aS,8aS,10S)-10-hydroxy-2,2,6a,6b,9,12a-hexamethyl-3,4,5,6,6a,7,8,8a,9,10,11,12,13,14b-tetradecahydro-1H-picen-4a-yl]ethanone |
| SMILES | CC(=O)[C@]12CCC(C)(C)CC1C1=CCC3C4(C)CC[C@H](O)C(C)[C@@H]4CCC3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C30H48O2/c1-19-21-10-13-29(7)25(27(21,5)12-11-24(19)32)9-8-22-23-18-26(3,4)14-16-30(23,20(2)31)17-15-28(22,29)6/h8,19,21,23-25,32H,9-18H2,1-7H3/t19?,21-,23?,24-,25?,27?,28+,29?,30+/m0/s1 |
| InChIKey | TYWOHMZLXSZHIX-GEPCLSJYSA-N |
| XLogP | 7.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|