C38H50N2O2 — CID 129072419
(1R,2R,11R,14R,15S,18S,21R,22S,23S)-2,10,10,14,15,21,22-heptamethyl-7-phenyl-6,8-diazahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4,6,8,24-tetraene-18-carboxylic acid (PubChem CID 129072419) has the molecular formula C38H50N2O2 and a molecular weight of 566.83 g/mol. Its IUPAC name is (1R,2R,11R,14R,15S,18S,21R,22S,23S)-2,10,10,14,15,21,22-heptamethyl-7-phenyl-6,8-diazahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4,6,8,24-tetraene-18-carboxylic acid.
| Compound Name | (1R,2R,11R,14R,15S,18S,21R,22S,23S)-2,10,10,14,15,21,22-heptamethyl-7-phenyl-6,8-diazahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4,6,8,24-tetraene-18-carboxylic acid |
|---|---|
| PubChem CID | 129072419 |
| Molecular Formula | C38H50N2O2 |
| Molecular Weight | 566.83 g/mol |
| Exact Mass | 566.39 |
| IUPAC Name | (1R,2R,11R,14R,15S,18S,21R,22S,23S)-2,10,10,14,15,21,22-heptamethyl-7-phenyl-6,8-diazahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4,6,8,24-tetraene-18-carboxylic acid |
| SMILES | C[C@H]1[C@H](C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)Cc6cnc(-c7ccccc7)nc6C(C)(C)[C@@H]5CC[C@]43C)[C@H]12 |
| InChI | InChI=1S/C38H50N2O2/c1-23-15-18-38(33(41)42)20-19-36(6)27(30(38)24(23)2)13-14-29-35(5)21-26-22-39-32(25-11-9-8-10-12-25)40-31(26)34(3,4)28(35)16-17-37(29,36)7/h8-13,22-24,28-30H,14-21H2,1-7H3,(H,41,42)/t23-,24+,28+,29-,30+,35+,36-,37-,38+/m1/s1 |
| InChIKey | QHCXIPFAWHJFBC-SNJGQZPMSA-N |
| XLogP | 8.90 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.83 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|