C34H47ClN2O3 — CID 135359054
6-carbamoyl-7-chloro-2,10,10,14,15,21,22-heptamethyl-8-azahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4,6,8,24-tetraene-18-carboxylic acid (PubChem CID 135359054) has the molecular formula C34H47ClN2O3 and a molecular weight of 567.21 g/mol. Its IUPAC name is 6-carbamoyl-7-chloro-2,10,10,14,15,21,22-heptamethyl-8-azahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4,6,8,24-tetraene-18-carboxylic acid.
| Compound Name | 6-carbamoyl-7-chloro-2,10,10,14,15,21,22-heptamethyl-8-azahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4,6,8,24-tetraene-18-carboxylic acid |
|---|---|
| PubChem CID | 135359054 |
| Molecular Formula | C34H47ClN2O3 |
| Molecular Weight | 567.21 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | 6-carbamoyl-7-chloro-2,10,10,14,15,21,22-heptamethyl-8-azahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4,6,8,24-tetraene-18-carboxylic acid |
| SMILES | CC1CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)Cc6cc(C(N)=O)c(Cl)nc6C(C)(C)C5CCC43C)C2C1C |
| InChI | InChI=1S/C34H47ClN2O3/c1-18-10-13-34(29(39)40)15-14-32(6)22(25(34)19(18)2)8-9-24-31(5)17-20-16-21(28(36)38)27(35)37-26(20)30(3,4)23(31)11-12-33(24,32)7/h8,16,18-19,23-25H,9-15,17H2,1-7H3,(H2,36,38)(H,39,40) |
| InChIKey | UKDKYJOOXQPUOV-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.21 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|