C43H53NO3 — CID 129072408
(1R,2R,15R,18R,19S,22S,25R,26S,27S)-2,14,14,18,19,25,26-heptamethyl-5-phenoxy-12-azaheptacyclo[16.12.0.02,15.04,13.06,11.019,28.022,27]triaconta-4,6,8,10,12,28-hexaene-22-carboxylic acid (PubChem CID 129072408) has the molecular formula C43H53NO3 and a molecular weight of 631.90 g/mol. Its IUPAC name is (1R,2R,15R,18R,19S,22S,25R,26S,27S)-2,14,14,18,19,25,26-heptamethyl-5-phenoxy-12-azaheptacyclo[16.12.0.02,15.04,13.06,11.019,28.022,27]triaconta-4,6,8,10,12,28-hexaene-22-carboxylic acid.
| Compound Name | (1R,2R,15R,18R,19S,22S,25R,26S,27S)-2,14,14,18,19,25,26-heptamethyl-5-phenoxy-12-azaheptacyclo[16.12.0.02,15.04,13.06,11.019,28.022,27]triaconta-4,6,8,10,12,28-hexaene-22-carboxylic acid |
|---|---|
| PubChem CID | 129072408 |
| Molecular Formula | C43H53NO3 |
| Molecular Weight | 631.90 g/mol |
| Exact Mass | 631.40 |
| IUPAC Name | (1R,2R,15R,18R,19S,22S,25R,26S,27S)-2,14,14,18,19,25,26-heptamethyl-5-phenoxy-12-azaheptacyclo[16.12.0.02,15.04,13.06,11.019,28.022,27]triaconta-4,6,8,10,12,28-hexaene-22-carboxylic acid |
| SMILES | C[C@H]1[C@H](C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)Cc6c(nc7ccccc7c6Oc6ccccc6)C(C)(C)[C@@H]5CC[C@]43C)[C@H]12 |
| InChI | InChI=1S/C43H53NO3/c1-26-19-22-43(38(45)46)24-23-41(6)31(35(43)27(26)2)17-18-34-40(5)25-30-36(47-28-13-9-8-10-14-28)29-15-11-12-16-32(29)44-37(30)39(3,4)33(40)20-21-42(34,41)7/h8-17,26-27,33-35H,18-25H2,1-7H3,(H,45,46)/t26-,27+,33+,34-,35+,40+,41-,42-,43+/m1/s1 |
| InChIKey | HXJFEESWWQPNRB-YSWRJRSPSA-N |
| XLogP | 10.78 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.90 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|