C40H54N2O3 — CID 129072318
benzyl (1R,2R,11R,14R,15S,18S,21R,22S,23S)-5-methoxy-2,10,10,14,15,21,22-heptamethyl-6,8-diazahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4(9),5,7,24-tetraene-18-carboxylate (PubChem CID 129072318) has the molecular formula C40H54N2O3 and a molecular weight of 610.88 g/mol. Its IUPAC name is benzyl (1R,2R,11R,14R,15S,18S,21R,22S,23S)-5-methoxy-2,10,10,14,15,21,22-heptamethyl-6,8-diazahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4(9),5,7,24-tetraene-18-carboxylate.
| Compound Name | benzyl (1R,2R,11R,14R,15S,18S,21R,22S,23S)-5-methoxy-2,10,10,14,15,21,22-heptamethyl-6,8-diazahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4(9),5,7,24-tetraene-18-carboxylate |
|---|---|
| PubChem CID | 129072318 |
| Molecular Formula | C40H54N2O3 |
| Molecular Weight | 610.88 g/mol |
| Exact Mass | 610.41 |
| IUPAC Name | benzyl (1R,2R,11R,14R,15S,18S,21R,22S,23S)-5-methoxy-2,10,10,14,15,21,22-heptamethyl-6,8-diazahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4(9),5,7,24-tetraene-18-carboxylate |
| SMILES | COc1ncnc2c1C[C@]1(C)[C@H]3CC=C4[C@@H]5[C@@H](C)[C@H](C)CC[C@]5(C(=O)OCc5ccccc5)CC[C@@]4(C)[C@]3(C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C40H54N2O3/c1-25-16-19-40(35(43)45-23-27-12-10-9-11-13-27)21-20-38(6)29(32(40)26(25)2)14-15-31-37(5)22-28-33(41-24-42-34(28)44-8)36(3,4)30(37)17-18-39(31,38)7/h9-14,24-26,30-32H,15-23H2,1-8H3/t25-,26+,30+,31-,32+,37+,38-,39-,40+/m1/s1 |
| InChIKey | SOZKBEMORVXIMW-KOBAFNMOSA-N |
| XLogP | 8.90 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.88 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|