C37H51BrO3 — CID 129072393
benzyl (1S,2R,6aR,6aS,6bR,8aR,12aR)-11-bromo-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxylate (PubChem CID 129072393) has the molecular formula C37H51BrO3 and a molecular weight of 623.72 g/mol. Its IUPAC name is benzyl (1S,2R,6aR,6aS,6bR,8aR,12aR)-11-bromo-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxylate.
| Compound Name | benzyl (1S,2R,6aR,6aS,6bR,8aR,12aR)-11-bromo-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 129072393 |
| Molecular Formula | C37H51BrO3 |
| Molecular Weight | 623.72 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | benzyl (1S,2R,6aR,6aS,6bR,8aR,12aR)-11-bromo-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| SMILES | C[C@@H]1CCC2(C(=O)OCc3ccccc3)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC(Br)C(=O)C(C)(C)[C@@H]5CC[C@]43C)C2[C@H]1C |
| InChI | InChI=1S/C37H51BrO3/c1-23-15-18-37(32(40)41-22-25-11-9-8-10-12-25)20-19-35(6)26(30(37)24(23)2)13-14-29-34(5)21-27(38)31(39)33(3,4)28(34)16-17-36(29,35)7/h8-13,23-24,27-30H,14-22H2,1-7H3/t23-,24+,27?,28+,29-,30?,34+,35-,36-,37?/m1/s1 |
| InChIKey | YPCIUFWQEGOFBX-GAEBMBSMSA-N |
| XLogP | 9.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.72 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|