C32H46N2O3S — CID 118609472
2,10,10,14,15,21,22-heptamethyl-5-oxo-7-sulfanylidene-6,8-diazahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4(9),24-diene-18-carboxylic acid (PubChem CID 118609472) has the molecular formula C32H46N2O3S and a molecular weight of 538.80 g/mol. Its IUPAC name is 2,10,10,14,15,21,22-heptamethyl-5-oxo-7-sulfanylidene-6,8-diazahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4(9),24-diene-18-carboxylic acid.
| Compound Name | 2,10,10,14,15,21,22-heptamethyl-5-oxo-7-sulfanylidene-6,8-diazahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4(9),24-diene-18-carboxylic acid |
|---|---|
| PubChem CID | 118609472 |
| Molecular Formula | C32H46N2O3S |
| Molecular Weight | 538.80 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | 2,10,10,14,15,21,22-heptamethyl-5-oxo-7-sulfanylidene-6,8-diazahexacyclo[12.12.0.02,11.04,9.015,24.018,23]hexacosa-4(9),24-diene-18-carboxylic acid |
| SMILES | CC1CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)Cc6c([nH]c(=S)[nH]c6=O)C(C)(C)C5CCC43C)C2C1C |
| InChI | InChI=1S/C32H46N2O3S/c1-17-10-13-32(26(36)37)15-14-30(6)20(23(32)18(17)2)8-9-22-29(5)16-19-24(33-27(38)34-25(19)35)28(3,4)21(29)11-12-31(22,30)7/h8,17-18,21-23H,9-16H2,1-7H3,(H,36,37)(H2,33,34,35,38) |
| InChIKey | MOCYFZMRHJGREE-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.80 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|