C36H53N5O — CID 157272759
1-[(1R,2S,5S,15R)-18-amino-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-trien-5-yl]-2-(5-amino-2H-pyrrol-3-yl)ethanone (PubChem CID 157272759) has the molecular formula C36H53N5O and a molecular weight of 571.85 g/mol. Its IUPAC name is 1-[(1R,2S,5S,15R)-18-amino-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-trien-5-yl]-2-(5-amino-2H-pyrrol-3-yl)ethanone.
| Compound Name | 1-[(1R,2S,5S,15R)-18-amino-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-trien-5-yl]-2-(5-amino-2H-pyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 157272759 |
| Molecular Formula | C36H53N5O |
| Molecular Weight | 571.85 g/mol |
| Exact Mass | 571.43 |
| IUPAC Name | 1-[(1R,2S,5S,15R)-18-amino-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-trien-5-yl]-2-(5-amino-2H-pyrrol-3-yl)ethanone |
| SMILES | CC1(C)CC[C@]2(C(=O)CC3=CC(N)=NC3)CC[C@]3(C)C(=CCC4[C@@]5(C)Cc6c(N)n[nH]c6C(C)(C)C5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C36H53N5O/c1-31(2)12-14-36(27(42)16-21-17-28(37)39-20-21)15-13-34(6)23(24(36)19-31)8-9-26-33(5)18-22-29(40-41-30(22)38)32(3,4)25(33)10-11-35(26,34)7/h8,17,24-26H,9-16,18-20H2,1-7H3,(H2,37,39)(H3,38,40,41)/t24?,25?,26?,33-,34+,35+,36-/m0/s1 |
| InChIKey | AABVUQUGMREGTD-VUGPVUTHSA-N |
| XLogP | 7.06 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.85 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|