C35H51N3O3 — CID 71065998
3-[(1R,2S,5S,6R,15R)-18-amino-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carbonyl]oxolan-2-one (PubChem CID 71065998) has the molecular formula C35H51N3O3 and a molecular weight of 561.81 g/mol. Its IUPAC name is 3-[(1R,2S,5S,6R,15R)-18-amino-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carbonyl]oxolan-2-one.
| Compound Name | 3-[(1R,2S,5S,6R,15R)-18-amino-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carbonyl]oxolan-2-one |
|---|---|
| PubChem CID | 71065998 |
| Molecular Formula | C35H51N3O3 |
| Molecular Weight | 561.81 g/mol |
| Exact Mass | 561.39 |
| IUPAC Name | 3-[(1R,2S,5S,6R,15R)-18-amino-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carbonyl]oxolan-2-one |
| SMILES | CC1(C)CC2C3=CCC4[C@@]5(C)Cc6c(N)n[nH]c6C(C)(C)C5CC[C@@]4(C)[C@]3(C)CC[C@@H]2[C@H](C(=O)C2CCOC2=O)C1 |
| InChI | InChI=1S/C35H51N3O3/c1-31(2)16-21-19(22(17-31)27(39)20-12-15-41-30(20)40)10-13-34(6)24(21)8-9-26-33(5)18-23-28(37-38-29(23)36)32(3,4)25(33)11-14-35(26,34)7/h8,19-22,25-26H,9-18H2,1-7H3,(H3,36,37,38)/t19-,20?,21?,22+,25?,26?,33-,34+,35+/m0/s1 |
| InChIKey | UXFGAICCNZJDRE-OJGJEROCSA-N |
| XLogP | 6.80 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.81 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|