C36H50N4O2 — CID 71066037
(6R)-18-amino-1,2,8,8,15,22,22-heptamethyl-12-pyridin-4-yl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid (PubChem CID 71066037) has the molecular formula C36H50N4O2 and a molecular weight of 570.82 g/mol. Its IUPAC name is (6R)-18-amino-1,2,8,8,15,22,22-heptamethyl-12-pyridin-4-yl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid.
| Compound Name | (6R)-18-amino-1,2,8,8,15,22,22-heptamethyl-12-pyridin-4-yl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
|---|---|
| PubChem CID | 71066037 |
| Molecular Formula | C36H50N4O2 |
| Molecular Weight | 570.82 g/mol |
| Exact Mass | 570.39 |
| IUPAC Name | (6R)-18-amino-1,2,8,8,15,22,22-heptamethyl-12-pyridin-4-yl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
| SMILES | CC1(C)CC2C3=C(c4ccncc4)CC4C5(C)Cc6c(N)n[nH]c6C(C)(C)C5CCC4(C)C3(C)CCC2[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C36H50N4O2/c1-32(2)17-23-21(24(18-32)31(41)42)8-12-36(7)28(23)22(20-10-14-38-15-11-20)16-27-34(5)19-25-29(39-40-30(25)37)33(3,4)26(34)9-13-35(27,36)6/h10-11,14-15,21,23-24,26-27H,8-9,12-13,16-19H2,1-7H3,(H,41,42)(H3,37,39,40)/t21?,23?,24-,26?,27?,34?,35?,36?/m1/s1 |
| InChIKey | MZIJABMVYIWTNW-XKZJOTSYSA-N |
| XLogP | 7.67 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.82 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |