C37H52N4O2 — CID 89242917
(1R,2S,5S,6R,10S,15R,23R)-18-amino-12-(3-aminophenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid (PubChem CID 89242917) has the molecular formula C37H52N4O2 and a molecular weight of 584.85 g/mol. Its IUPAC name is (1R,2S,5S,6R,10S,15R,23R)-18-amino-12-(3-aminophenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid.
| Compound Name | (1R,2S,5S,6R,10S,15R,23R)-18-amino-12-(3-aminophenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
|---|---|
| PubChem CID | 89242917 |
| Molecular Formula | C37H52N4O2 |
| Molecular Weight | 584.85 g/mol |
| Exact Mass | 584.41 |
| IUPAC Name | (1R,2S,5S,6R,10S,15R,23R)-18-amino-12-(3-aminophenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
| SMILES | CC1(C)C[C@@H]2C3=C(c4cccc(N)c4)CC4[C@@]5(C)Cc6c(N)n[nH]c6C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)CC[C@@H]2[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C37H52N4O2/c1-33(2)17-24-22(25(18-33)32(42)43)11-13-37(7)29(24)23(20-9-8-10-21(38)15-20)16-28-35(5)19-26-30(40-41-31(26)39)34(3,4)27(35)12-14-36(28,37)6/h8-10,15,22,24-25,27-28H,11-14,16-19,38H2,1-7H3,(H,42,43)(H3,39,40,41)/t22-,24-,25+,27-,28?,35-,36+,37+/m0/s1 |
| InChIKey | NGJHJIXWHBZTSG-LOFIWTIUSA-N |
| XLogP | 7.86 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.85 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|