C32H49N3O2 — CID 71066087
(1R,2S,5S,6R,10S,15R,23R)-18-amino-1,2,8,8,12,15,22,22-octamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid (PubChem CID 71066087) has the molecular formula C32H49N3O2 and a molecular weight of 507.76 g/mol. Its IUPAC name is (1R,2S,5S,6R,10S,15R,23R)-18-amino-1,2,8,8,12,15,22,22-octamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid.
| Compound Name | (1R,2S,5S,6R,10S,15R,23R)-18-amino-1,2,8,8,12,15,22,22-octamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
|---|---|
| PubChem CID | 71066087 |
| Molecular Formula | C32H49N3O2 |
| Molecular Weight | 507.76 g/mol |
| Exact Mass | 507.38 |
| IUPAC Name | (1R,2S,5S,6R,10S,15R,23R)-18-amino-1,2,8,8,12,15,22,22-octamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
| SMILES | CC1=C2[C@H]3CC(C)(C)C[C@@H](C(=O)O)[C@H]3CC[C@@]2(C)[C@]2(C)CC[C@H]3C(C)(C)c4[nH]nc(N)c4C[C@]3(C)C2C1 |
| InChI | InChI=1S/C32H49N3O2/c1-17-13-23-30(6)16-21-25(34-35-26(21)33)29(4,5)22(30)10-12-31(23,7)32(8)11-9-18-19(24(17)32)14-28(2,3)15-20(18)27(36)37/h18-20,22-23H,9-16H2,1-8H3,(H,36,37)(H3,33,34,35)/t18-,19-,20+,22-,23?,30-,31+,32+/m0/s1 |
| InChIKey | ZLGXVXWDIXGMQW-MSWIBTTFSA-N |
| XLogP | 7.14 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.76 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|