C32H47N5OS — CID 71066066
5-[(1R,2S,5S,6R,15R)-18-amino-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-trien-6-yl]-3H-1,3,4-thiadiazol-2-one (PubChem CID 71066066) has the molecular formula C32H47N5OS and a molecular weight of 549.83 g/mol. Its IUPAC name is 5-[(1R,2S,5S,6R,15R)-18-amino-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-trien-6-yl]-3H-1,3,4-thiadiazol-2-one.
| Compound Name | 5-[(1R,2S,5S,6R,15R)-18-amino-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-trien-6-yl]-3H-1,3,4-thiadiazol-2-one |
|---|---|
| PubChem CID | 71066066 |
| Molecular Formula | C32H47N5OS |
| Molecular Weight | 549.83 g/mol |
| Exact Mass | 549.35 |
| IUPAC Name | 5-[(1R,2S,5S,6R,15R)-18-amino-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-trien-6-yl]-3H-1,3,4-thiadiazol-2-one |
| SMILES | CC1(C)CC2C3=CCC4[C@@]5(C)Cc6c(N)n[nH]c6C(C)(C)C5CC[C@@]4(C)[C@]3(C)CC[C@@H]2[C@H](c2n[nH]c(=O)s2)C1 |
| InChI | InChI=1S/C32H47N5OS/c1-28(2)14-18-17(19(15-28)26-36-37-27(38)39-26)10-12-31(6)21(18)8-9-23-30(5)16-20-24(34-35-25(20)33)29(3,4)22(30)11-13-32(23,31)7/h8,17-19,22-23H,9-16H2,1-7H3,(H,37,38)(H3,33,34,35)/t17-,18?,19+,22?,23?,30-,31+,32+/m0/s1 |
| InChIKey | GYOGYWOQFLCRED-SMRWNRPISA-N |
| XLogP | 6.98 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.83 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|