C35H54ClN3O3 — CID 71065939
ethyl 3-[(1R,2S,5S,6R,15R)-18-amino-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-trien-6-yl]-3-oxopropanoate;hydrochloride (PubChem CID 71065939) has the molecular formula C35H54ClN3O3 and a molecular weight of 600.29 g/mol. Its IUPAC name is ethyl 3-[(1R,2S,5S,6R,15R)-18-amino-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-trien-6-yl]-3-oxopropanoate;hydrochloride.
| Compound Name | ethyl 3-[(1R,2S,5S,6R,15R)-18-amino-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-trien-6-yl]-3-oxopropanoate;hydrochloride |
|---|---|
| PubChem CID | 71065939 |
| Molecular Formula | C35H54ClN3O3 |
| Molecular Weight | 600.29 g/mol |
| Exact Mass | 599.39 |
| IUPAC Name | ethyl 3-[(1R,2S,5S,6R,15R)-18-amino-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-trien-6-yl]-3-oxopropanoate;hydrochloride |
| SMILES | CCOC(=O)CC(=O)[C@@H]1CC(C)(C)CC2C3=CCC4[C@@]5(C)Cc6c(N)n[nH]c6C(C)(C)C5CC[C@@]4(C)[C@]3(C)CC[C@@H]21.Cl |
| InChI | InChI=1S/C35H53N3O3.ClH/c1-9-41-28(40)16-25(39)22-18-31(2,3)17-21-20(22)12-14-34(7)24(21)10-11-27-33(6)19-23-29(37-38-30(23)36)32(4,5)26(33)13-15-35(27,34)8;/h10,20-22,26-27H,9,11-19H2,1-8H3,(H3,36,37,38);1H/t20-,21?,22+,26?,27?,33-,34+,35+;/m0./s1 |
| InChIKey | WLYMGOPDCDHKNO-ZZJWCGGUSA-N |
| XLogP | 7.61 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.29 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|