C34H52N6 — CID 71079007
(1R,2S,5S,15R)-5-(5-amino-1-methylpyrazol-3-yl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-trien-18-amine (PubChem CID 71079007) has the molecular formula C34H52N6 and a molecular weight of 544.83 g/mol. Its IUPAC name is (1R,2S,5S,15R)-5-(5-amino-1-methylpyrazol-3-yl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-trien-18-amine.
| Compound Name | (1R,2S,5S,15R)-5-(5-amino-1-methylpyrazol-3-yl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-trien-18-amine |
|---|---|
| PubChem CID | 71079007 |
| Molecular Formula | C34H52N6 |
| Molecular Weight | 544.83 g/mol |
| Exact Mass | 544.43 |
| IUPAC Name | (1R,2S,5S,15R)-5-(5-amino-1-methylpyrazol-3-yl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-trien-18-amine |
| SMILES | Cn1nc([C@]23CCC(C)(C)CC2C2=CCC4[C@@]5(C)Cc6c(N)n[nH]c6C(C)(C)C5CC[C@@]4(C)[C@]2(C)CC3)cc1N |
| InChI | InChI=1S/C34H52N6/c1-29(2)13-15-34(25-17-26(35)40(8)39-25)16-14-32(6)21(22(34)19-29)9-10-24-31(5)18-20-27(37-38-28(20)36)30(3,4)23(31)11-12-33(24,32)7/h9,17,22-24H,10-16,18-19,35H2,1-8H3,(H3,36,37,38)/t22?,23?,24?,31-,32+,33+,34-/m0/s1 |
| InChIKey | FIEIMCZNFBVMIZ-DVQJNRHRSA-N |
| XLogP | 7.07 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.83 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|