C38H60N4O — CID 86267912
(1R,2S,5S,10S,14R,15R)-1,2,8,8,15,22,22-heptamethyl-N-(2-piperidin-1-ylethyl)-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxamide (PubChem CID 86267912) has the molecular formula C38H60N4O and a molecular weight of 588.93 g/mol. Its IUPAC name is (1R,2S,5S,10S,14R,15R)-1,2,8,8,15,22,22-heptamethyl-N-(2-piperidin-1-ylethyl)-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxamide.
| Compound Name | (1R,2S,5S,10S,14R,15R)-1,2,8,8,15,22,22-heptamethyl-N-(2-piperidin-1-ylethyl)-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxamide |
|---|---|
| PubChem CID | 86267912 |
| Molecular Formula | C38H60N4O |
| Molecular Weight | 588.93 g/mol |
| Exact Mass | 588.48 |
| IUPAC Name | (1R,2S,5S,10S,14R,15R)-1,2,8,8,15,22,22-heptamethyl-N-(2-piperidin-1-ylethyl)-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxamide |
| SMILES | CC1(C)CC[C@]2(C(=O)NCCN3CCCCC3)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)Cc6cn[nH]c6C(C)(C)C5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C38H60N4O/c1-33(2)15-17-38(32(43)39-19-22-42-20-9-8-10-21-42)18-16-36(6)27(28(38)24-33)11-12-30-35(5)23-26-25-40-41-31(26)34(3,4)29(35)13-14-37(30,36)7/h11,25,28-30H,8-10,12-24H2,1-7H3,(H,39,43)(H,40,41)/t28-,29?,30+,35-,36+,37+,38-/m0/s1 |
| InChIKey | WDVXCAUCLKNXMU-JDNGFGBCSA-N |
| XLogP | 7.83 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.93 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|