C25H42 — CID 143115274
3,4,4,10,13-pentamethyl-17-propan-2-yl-1,2,3,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 143115274) has the molecular formula C25H42 and a molecular weight of 342.61 g/mol. Its IUPAC name is 3,4,4,10,13-pentamethyl-17-propan-2-yl-1,2,3,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | 3,4,4,10,13-pentamethyl-17-propan-2-yl-1,2,3,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 143115274 |
| Molecular Formula | C25H42 |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 342.33 |
| IUPAC Name | 3,4,4,10,13-pentamethyl-17-propan-2-yl-1,2,3,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | CC(C)C1CCC2C3=CCC4C(C)(C)C(C)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C25H42/c1-16(2)19-9-10-20-18-8-11-22-23(4,5)17(3)12-14-25(22,7)21(18)13-15-24(19,20)6/h8,16-17,19-22H,9-15H2,1-7H3 |
| InChIKey | RYEOQHNRWWKLPQ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|