C27H44 — CID 45044030
(8aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-8a,10a-dimethyl-1,2,3,3a,5,5a,6,7,8,8b,9,10-dodecahydroindeno[5,4-e]indene (PubChem CID 45044030) has the molecular formula C27H44 and a molecular weight of 368.65 g/mol. Its IUPAC name is (8aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-8a,10a-dimethyl-1,2,3,3a,5,5a,6,7,8,8b,9,10-dodecahydroindeno[5,4-e]indene.
| Compound Name | (8aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-8a,10a-dimethyl-1,2,3,3a,5,5a,6,7,8,8b,9,10-dodecahydroindeno[5,4-e]indene |
|---|---|
| PubChem CID | 45044030 |
| Molecular Formula | C27H44 |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 368.34 |
| IUPAC Name | (8aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-8a,10a-dimethyl-1,2,3,3a,5,5a,6,7,8,8b,9,10-dodecahydroindeno[5,4-e]indene |
| SMILES | CC(C)[C@@H](C)/C=C/[C@@H](C)C1CCC2C3=CCC4CCC[C@@]4(C)C3CCC21C |
| InChI | InChI=1S/C27H44/c1-18(2)19(3)9-10-20(4)23-13-14-24-22-12-11-21-8-7-16-26(21,5)25(22)15-17-27(23,24)6/h9-10,12,18-21,23-25H,7-8,11,13-17H2,1-6H3/b10-9+/t19-,20+,21?,23?,24?,25?,26+,27?/m0/s1 |
| InChIKey | VOYKELMCSUDIBK-DYFPWNIDSA-N |
| XLogP | 8.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|