C30H48O — CID 58521556
(10S,13R)-10,13-dimethyl-17-[(E,2R,5S,6R)-5,6,7-trimethyloct-3-en-2-yl]-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 58521556) has the molecular formula C30H48O and a molecular weight of 424.71 g/mol. Its IUPAC name is (10S,13R)-10,13-dimethyl-17-[(E,2R,5S,6R)-5,6,7-trimethyloct-3-en-2-yl]-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10S,13R)-10,13-dimethyl-17-[(E,2R,5S,6R)-5,6,7-trimethyloct-3-en-2-yl]-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 58521556 |
| Molecular Formula | C30H48O |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.37 |
| IUPAC Name | (10S,13R)-10,13-dimethyl-17-[(E,2R,5S,6R)-5,6,7-trimethyloct-3-en-2-yl]-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)[C@@H](C)[C@@H](C)/C=C/[C@@H](C)C1CCC2C3=CCC4CC(=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C30H48O/c1-19(2)22(5)20(3)8-9-21(4)26-12-13-27-25-11-10-23-18-24(31)14-16-29(23,6)28(25)15-17-30(26,27)7/h8-9,11,19-23,26-28H,10,12-18H2,1-7H3/b9-8+/t20-,21+,22+,23?,26?,27?,28?,29-,30+/m0/s1 |
| InChIKey | KSJVIKFGSWGQDT-YGNLXGJLSA-N |
| XLogP | 8.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|