C29H47NO — CID 175004183
N-[[(9R,10S,13R,14R,17R)-17-[(2R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methylidene]hydroxylamine (PubChem CID 175004183) has the molecular formula C29H47NO and a molecular weight of 425.70 g/mol. Its IUPAC name is N-[[(9R,10S,13R,14R,17R)-17-[(2R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methylidene]hydroxylamine.
| Compound Name | N-[[(9R,10S,13R,14R,17R)-17-[(2R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 175004183 |
| Molecular Formula | C29H47NO |
| Molecular Weight | 425.70 g/mol |
| Exact Mass | 425.37 |
| IUPAC Name | N-[[(9R,10S,13R,14R,17R)-17-[(2R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methylidene]hydroxylamine |
| SMILES | CC(C)C(C)C=C[C@@H](C)[C@H]1CC[C@H]2C3=CCC4CC(C=NO)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H47NO/c1-19(2)20(3)7-8-21(4)25-11-12-26-24-10-9-23-17-22(18-30-31)13-15-28(23,5)27(24)14-16-29(25,26)6/h7-8,10,18-23,25-27,31H,9,11-17H2,1-6H3/t20?,21-,22?,23?,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | JVCDOFLGXMDSQA-DRJOVJJZSA-N |
| XLogP | 8.13 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.70 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|