C33H54O5 — CID 74052644
2-[[17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol (PubChem CID 74052644) has the molecular formula C33H54O5 and a molecular weight of 530.79 g/mol. Its IUPAC name is 2-[[17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol.
| Compound Name | 2-[[17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 74052644 |
| Molecular Formula | C33H54O5 |
| Molecular Weight | 530.79 g/mol |
| Exact Mass | 530.40 |
| IUPAC Name | 2-[[17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol |
| SMILES | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(OC5OCC(O)C(O)C5O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C33H54O5/c1-19(2)20(3)7-8-21(4)25-11-12-26-24-10-9-22-17-23(38-31-30(36)29(35)28(34)18-37-31)13-15-32(22,5)27(24)14-16-33(25,26)6/h7-8,10,19-23,25-31,34-36H,9,11-18H2,1-6H3 |
| InChIKey | SAJCQEWAWMAPGF-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.79 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|