C29H48O2 — CID 45044484
(5S,11R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3-methoxy-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-11-ol (PubChem CID 45044484) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is (5S,11R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3-methoxy-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-11-ol.
| Compound Name | (5S,11R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3-methoxy-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-11-ol |
|---|---|
| PubChem CID | 45044484 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | (5S,11R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3-methoxy-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-11-ol |
| SMILES | COC1CCC2(C)C3C(=CC[C@H]2C1)C1CCC([C@H](C)/C=C/[C@H](C)C(C)C)C1(C)C[C@H]3O |
| InChI | InChI=1S/C29H48O2/c1-18(2)19(3)8-9-20(4)24-12-13-25-23-11-10-21-16-22(31-7)14-15-28(21,5)27(23)26(30)17-29(24,25)6/h8-9,11,18-22,24-27,30H,10,12-17H2,1-7H3/b9-8+/t19-,20+,21-,22?,24?,25?,26+,27?,28?,29?/m0/s1 |
| InChIKey | SKYFSJBNMQKIPR-YPHXKOAZSA-N |
| XLogP | 7.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|