C23H38O2 — CID 169180129
(3S,10S,13S)-17-(1-hydroxy-2-methylpropan-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 169180129) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is (3S,10S,13S)-17-(1-hydroxy-2-methylpropan-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10S,13S)-17-(1-hydroxy-2-methylpropan-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 169180129 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | (3S,10S,13S)-17-(1-hydroxy-2-methylpropan-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)(CO)C1CCC2C3=CCC4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C23H38O2/c1-21(2,14-24)20-8-7-18-17-6-5-15-13-16(25)9-11-22(15,3)19(17)10-12-23(18,20)4/h6,15-16,18-20,24-25H,5,7-14H2,1-4H3/t15?,16-,18?,19?,20?,22-,23-/m0/s1 |
| InChIKey | YWHCVJSSLHWSQU-SJNWYCKJSA-N |
| XLogP | 4.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|