C29H43NO3 — CID 138579879
(1S,5R,14S,15R,23R)-5-hydroxy-1,8,8,15,22,22-hexamethyl-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-17(21),18-dien-12-one (PubChem CID 138579879) has the molecular formula C29H43NO3 and a molecular weight of 453.67 g/mol. Its IUPAC name is (1S,5R,14S,15R,23R)-5-hydroxy-1,8,8,15,22,22-hexamethyl-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-17(21),18-dien-12-one.
| Compound Name | (1S,5R,14S,15R,23R)-5-hydroxy-1,8,8,15,22,22-hexamethyl-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-17(21),18-dien-12-one |
|---|---|
| PubChem CID | 138579879 |
| Molecular Formula | C29H43NO3 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | (1S,5R,14S,15R,23R)-5-hydroxy-1,8,8,15,22,22-hexamethyl-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-17(21),18-dien-12-one |
| SMILES | CC1(C)CC[C@]2(O)CCC3C(C(=O)C[C@@H]4[C@@]5(C)Cc6cnoc6C(C)(C)[C@@H]5CC[C@@]34C)C2C1 |
| InChI | InChI=1S/C29H43NO3/c1-25(2)11-12-29(32)10-7-18-23(19(29)15-25)20(31)13-22-27(18,5)9-8-21-26(3,4)24-17(16-30-33-24)14-28(21,22)6/h16,18-19,21-23,32H,7-15H2,1-6H3/t18?,19?,21-,22-,23?,27-,28-,29+/m0/s1 |
| InChIKey | HJYZVLIPGQFOEU-VGYOGLADSA-N |
| XLogP | 6.10 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |