About CID 140592348
CID 140592348 (PubChem CID 140592348) has the molecular formula C30H43NO3
and a molecular weight of 465.68 g/mol.
Molecular Properties
| Compound Name | CID 140592348 |
| PubChem CID | 140592348 |
| Molecular Formula | C30H43NO3 |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.32 |
| IUPAC Name | — |
| SMILES | CC1(C)CC[C@]2(O)CC[C@]3(C)[C]([C]2C1)C(=O)C[C@@H]1[C@@]2(C)Cc4cnoc4C(C)(C)[C@@H]2CC[C@]13C |
| InChI | InChI=1S/C30H43NO3/c1-25(2)10-12-30(33)13-11-29(7)23(19(30)16-25)20(32)14-22-27(5)15-18-17-31-34-24(18)26(3,4)21(27)8-9-28(22,29)6/h17,21-22,33H,8-16H2,1-7H3/t21-,22+,27-,28+,29+,30-/m0/s1 |
| InChIKey | JRFLAICPNZASBA-WDJVMFSYSA-N |
| XLogP | 6.41 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 140592348 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140592348?
The IUPAC name of CID 140592348 (CID 140592348) is not available.
What is the SMILES notation for CID 140592348?
The canonical SMILES for CID 140592348 is CC1(C)CC[C@]2(O)CC[C@]3(C)[C]([C]2C1)C(=O)C[C@@H]1[C@@]2(C)Cc4cnoc4C(C)(C)[C@@H]2CC[C@]13C.
What is the InChIKey of CID 140592348?
The InChIKey is JRFLAICPNZASBA-WDJVMFSYSA-N. The full InChI is InChI=1S/C30H43NO3/c1-25(2)10-12-30(33)13-11-29(7)23(19(30)16-25)20(32)14-22-27(5)15-18-17-31-34-24(18)26(3,4)21(27)8-9-28(22,29)6/h17,21-22,33H,8-16H2,1-7H3/t21-,22+,27-,28+,29+,30-/m0/s1.
What are the key properties of CID 140592348?
CID 140592348 has a molecular weight of 465.68 g/mol, XLogP of 6.41, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140592348 is sourced from PubChem (CID 140592348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).