C30H43NO3 — CID 140592348
CID 140592348 (PubChem CID 140592348) has the molecular formula C30H43NO3 and a molecular weight of 465.68 g/mol.
| Compound Name | CID 140592348 |
|---|---|
| PubChem CID | 140592348 |
| Molecular Formula | C30H43NO3 |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.32 |
| IUPAC Name | — |
| SMILES | CC1(C)CC[C@]2(O)CC[C@]3(C)[C]([C]2C1)C(=O)C[C@@H]1[C@@]2(C)Cc4cnoc4C(C)(C)[C@@H]2CC[C@]13C |
| InChI | InChI=1S/C30H43NO3/c1-25(2)10-12-30(33)13-11-29(7)23(19(30)16-25)20(32)14-22-27(5)15-18-17-31-34-24(18)26(3,4)21(27)8-9-28(22,29)6/h17,21-22,33H,8-16H2,1-7H3/t21-,22+,27-,28+,29+,30-/m0/s1 |
| InChIKey | JRFLAICPNZASBA-WDJVMFSYSA-N |
| XLogP | 6.41 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |